For research use only. Not for therapeutic Use.
Methyl 2-amino-4-bromothiophene-3-carboxylate is a specialized chemical compound used in pharmaceutical and organic synthesis. Featuring a thiophene ring structure with an amino group, bromine atom, and carboxylate ester, it plays a significant role in the development of biologically active molecules. This compound is often used in the synthesis of heterocyclic compounds and serves as a key intermediate in the creation of potential drug candidates, particularly for applications in anti-inflammatory and anticancer research.
CAS Number | 1239461-22-3 |
Molecular Formula | C6H6BrNO2S |
Purity | ≥95% |
IUPAC Name | methyl 2-amino-4-bromothiophene-3-carboxylate |
InChI | InChI=1S/C6H6BrNO2S/c1-10-6(9)4-3(7)2-11-5(4)8/h2H,8H2,1H3 |
InChIKey | URQGFCZFMUBHBN-UHFFFAOYSA-N |
SMILES | COC(=O)C1=C(SC=C1Br)N |