For research use only. Not for therapeutic Use.
Methyl 2-amino-4-methyl-1,3-thiazole-5-carboxylate(Cat No.:M321824)is a heterocyclic compound used as an intermediate in the synthesis of pharmaceuticals and bioactive molecules. This compound features an amino group at the 2-position, a methyl group at the 4-position, and a methyl ester at the 5-position on the thiazole ring. Its structure provides multiple reactive sites, making it valuable for creating complex molecules in medicinal chemistry. It is particularly useful in the development of drugs and agrochemicals, where it serves as a key building block for various synthetic pathways and chemical modifications.
CAS Number | 3829-80-9 |
Molecular Formula | C6H8N2O2S |
Purity | ≥95% |
IUPAC Name | methyl 2-amino-4-methyl-1,3-thiazole-5-carboxylate |
InChI | InChI=1S/C6H8N2O2S/c1-3-4(5(9)10-2)11-6(7)8-3/h1-2H3,(H2,7,8) |
InChIKey | TYUGYIMCRDPMPJ-UHFFFAOYSA-N |
SMILES | CC1=C(SC(=N1)N)C(=O)OC |