For research use only. Not for therapeutic Use.
Methyl 2-amino-6-methoxybenzoate hydrochloride(Cat No.:L049131)is a benzoate derivative featuring an amino group at the 2-position and a methoxy group at the 6-position, with the compound in its hydrochloride salt form. This compound is commonly used in pharmaceutical research and organic synthesis as an intermediate in the production of various bioactive molecules. The hydrochloride form enhances its solubility and stability, making it suitable for diverse chemical reactions. Methyl 2-amino-6-methoxybenzoate hydrochloride is essential for the development of novel therapeutic agents and other specialized compounds.
CAS Number | 1448009-40-2 |
Molecular Formula | C9H12ClNO3 |
Purity | ≥95% |
IUPAC Name | methyl 2-amino-6-methoxybenzoate;hydrochloride |
InChI | InChI=1S/C9H11NO3.ClH/c1-12-7-5-3-4-6(10)8(7)9(11)13-2;/h3-5H,10H2,1-2H3;1H |
InChIKey | GYSPHNWNOAKZCB-UHFFFAOYSA-N |
SMILES | COC1=CC=CC(=C1C(=O)OC)N.Cl |