Home
>
Chemical Reagents>Heterocyclic Building Blocks>
>
Methyl 2-azabicyclo[2.1.1]hexane-5-carboxylate hydrochloride
Methyl 2-azabicyclo[2.1.1]hexane-5-carboxylate hydrochloride(Cat No.:L007740), is a chemical compound with potential applications in medicinal and pharmaceutical research. This compound belongs to the class of azabicyclohexane derivatives, characterized by a unique bicyclic structure. Researchers are interested in its pharmaceutical properties, investigating its potential as a drug candidate or as a building block for the synthesis of biologically active molecules. The hydrochloride salt form enhances its stability and solubility in various experimental conditions. Scientists study its chemical properties, reactivity, and interactions to develop novel drugs or explore its role in chemical synthesis.
Catalog Number | L007740 |
CAS Number | 1824260-58-3 |
Molecular Formula | C7H12ClNO2 |
Purity | ≥95% |
IUPAC Name | methyl 2-azabicyclo[2.1.1]hexane-5-carboxylate;hydrochloride |
InChI | InChI=1S/C7H11NO2.ClH/c1-10-7(9)6-4-2-5(6)8-3-4;/h4-6,8H,2-3H2,1H3;1H |
InChIKey | GMPGBNGGBCTYHE-UHFFFAOYSA-N |
SMILES | COC(=O)C1C2CC1NC2.Cl |