For research use only. Not for therapeutic Use.
Methyl 2-bromo-3-phenylpropanoate(Cat No.:L017135)is a brominated ester known for its role as a versatile intermediate in organic synthesis. This compound features a bromine atom attached to a secondary carbon, adjacent to a phenyl group and an ester functional group. It is particularly useful in the preparation of pharmaceuticals and agrochemicals through various synthetic routes, including Michael addition reactions and nucleophilic substitutions. Its utility extends to the synthesis of complex molecules such as fragrances and polymers, demonstrating its wide applicability in both academic research and industrial chemistry.
CAS Number | 3196-22-3 |
Molecular Formula | C10H11BrO2 |
Purity | ≥95% |
IUPAC Name | methyl 2-bromo-3-phenylpropanoate |
InChI | InChI=1S/C10H11BrO2/c1-13-10(12)9(11)7-8-5-3-2-4-6-8/h2-6,9H,7H2,1H3 |
InChIKey | OUCLVXLFVUBZAV-UHFFFAOYSA-N |
SMILES | COC(=O)C(CC1=CC=CC=C1)Br |