For research use only. Not for therapeutic Use.
Methyl 2-bromo-4-chloro-6-fluorobenzoate (Cat.No:L003321) is a key chemical compound in pharmaceutical research. Its distinct structure serves as a crucial scaffold in the synthesis of novel pharmaceutical agents, demonstrating its significance in drug development endeavors.
Catalog Number | L003321 |
CAS Number | 943975-33-5 |
Molecular Formula | C8H5BrClFO2 |
Purity | ≥95% |
IUPAC Name | methyl 2-bromo-4-chloro-6-fluorobenzoate |
InChI | InChI=1S/C8H5BrClFO2/c1-13-8(12)7-5(9)2-4(10)3-6(7)11/h2-3H,1H3 |
InChIKey | ZHDQAVDNSOHLEO-UHFFFAOYSA-N |
SMILES | COC(=O)C1=C(C=C(C=C1Br)Cl)F |