For research use only. Not for therapeutic Use.
Methyl 2-bromoimidazo[1,2-a]pyridine-6-carboxylate(Cat No.:L040528)is a brominated heterocyclic compound widely used in pharmaceutical and chemical research. Featuring a bromine atom at the 2-position and a carboxylate ester group at the 6-position on the imidazo[1,2-a]pyridine core, this compound serves as a valuable intermediate in synthesizing bioactive molecules, particularly in drug discovery and development. Its unique structure allows for various chemical modifications, making it essential for creating complex organic compounds. Methyl 2-bromoimidazo[1,2-a]pyridine-6-carboxylate is crucial for researchers focused on innovative medicinal chemistry.
Catalog Number | L040528 |
CAS Number | 1042141-37-6 |
Molecular Formula | C9H7BrN2O2 |
Purity | ≥95% |
IUPAC Name | methyl 2-bromoimidazo[1,2-a]pyridine-6-carboxylate |
InChI | InChI=1S/C9H7BrN2O2/c1-14-9(13)6-2-3-8-11-7(10)5-12(8)4-6/h2-5H,1H3 |
InChIKey | QIPNKRNFZTZQBD-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CN2C=C(N=C2C=C1)Br |