For research use only. Not for therapeutic Use.
Methyl 2-Bromopropionate(Cat No.:R021339)is a versatile compound widely used in organic synthesis and pharmaceutical research. This brominated ester serves as a crucial building block for creating a variety of complex molecules, including agrochemicals, pharmaceuticals, and polymers. Its structure, featuring a bromine atom and an ester group, allows for diverse chemical reactions, including nucleophilic substitution and esterification. With high purity and reactivity, Methyl 2-Bromopropionate is essential for researchers engaged in developing new chemical entities, facilitating precise modifications in synthetic chemistry and drug discovery projects.
CAS Number | 5445-17-0 |
Synonyms | (±)-Methyl 2-bBromopropionate; 2-Bromopropanoic Acid Methyl Ester; 2-Bromopropionic Acid Methyl Ester; DL-α-Bromopropionic Acid Methyl Ester; Methyl (±)-α-Bromopropionate; Methyl 2-Bromopropanoate; Methyl 2-Bromopropionate; Methyl DL-2-Bromopropanoat |
Molecular Formula | C4H7BrO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | Methyl 2-Bromopropionate |
InChI | InChI=1S/C4H7BrO2/c1-3(5)4(6)7-2/h3H,1-2H3 |
InChIKey | ACEONLNNWKIPTM-UHFFFAOYSA-N |
SMILES | CC(C(=O)OC)Br |