For research use only. Not for therapeutic Use.
Methyl 2-chloro-5-hydroxybenzoate(Cat No.:L044784)is an aromatic ester commonly used in pharmaceutical and chemical research. Featuring a chloro and hydroxy group on a benzoate backbone, this compound is a key intermediate in the synthesis of various biologically active molecules, including potential drug candidates. Its structure provides unique reactivity, making it suitable for a range of chemical transformations, such as esterification and substitution reactions. Researchers in medicinal chemistry and synthetic organic chemistry value this compound for its role in developing innovative therapies and fine chemicals.
CAS Number | 247092-10-0 |
Molecular Formula | C8H7ClO3 |
Purity | ≥95% |
IUPAC Name | methyl 2-chloro-5-hydroxybenzoate |
InChI | InChI=1S/C8H7ClO3/c1-12-8(11)6-4-5(10)2-3-7(6)9/h2-4,10H,1H3 |
InChIKey | UCNCJYKKAJVLQK-UHFFFAOYSA-N |
SMILES | COC(=O)C1=C(C=CC(=C1)O)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |