For research use only. Not for therapeutic Use.
Methyl 2-(chlorosulfonyl)-4-fluorobenzoate(Cat No.:L007609), is a chemical compound featuring a benzoate backbone substituted with a sulfonyl chloride group at the 2-position and a fluorine atom at the 4-position. This specific molecular structure is valuable in organic synthesis and medicinal chemistry. Researchers utilize it as a versatile reagent for the introduction of a sulfonyl chloride group in various organic molecules. Its reactivity allows for diverse chemical transformations, making it instrumental in the creation of complex compounds.
CAS Number | 1156254-63-5 |
Molecular Formula | C8H6ClFO4S |
Purity | ≥95% |
IUPAC Name | methyl 2-chlorosulfonyl-4-fluorobenzoate |
InChI | InChI=1S/C8H6ClFO4S/c1-14-8(11)6-3-2-5(10)4-7(6)15(9,12)13/h2-4H,1H3 |
InChIKey | TUNCTHJWHJYMPD-UHFFFAOYSA-N |
SMILES | COC(=O)C1=C(C=C(C=C1)F)S(=O)(=O)Cl |