For research use only. Not for therapeutic Use.
Methyl 2-cyano-3-nitrobenzoate(Cat No.:L029054)is a chemical compound characterized by a benzoate ester framework substituted with cyano and nitro groups. This structure enhances its reactivity, making it a valuable intermediate in the synthesis of dyes, pharmaceuticals, and polymers. The cyano group increases the molecule’s nitrile functionality, useful in further chemical transformations such as nucleophilic addition reactions. Simultaneously, the nitro group provides avenues for reduction reactions and can act as an electron-withdrawing group, facilitating aromatic electrophilic substitution. This compound is crucial in developing advanced organic materials with specific optical and electronic properties.
CAS Number | 77326-46-6 |
Molecular Formula | C9H6N2O4 |
Purity | ≥95% |
IUPAC Name | methyl 2-cyano-3-nitrobenzoate |
InChI | InChI=1S/C9H6N2O4/c1-15-9(12)6-3-2-4-8(11(13)14)7(6)5-10/h2-4H,1H3 |
InChIKey | IKKNSRWBYKCBBC-UHFFFAOYSA-N |
SMILES | COC(=O)C1=C(C(=CC=C1)[N+](=O)[O-])C#N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |