For research use only. Not for therapeutic Use.
Methyl 2-cyano-4-fluoro-6-methylbenzoate(Cat No.:L034778)is a high-purity aromatic ester widely used in pharmaceutical and chemical research. This compound features a benzoate core with a cyano group at the 2-position, a fluorine atom at the 4-position, and a methyl group at the 6-position, along with a methyl ester functional group. It serves as a versatile intermediate in the synthesis of bioactive molecules, including potential drug candidates. Its unique structure allows for selective reactivity in various chemical transformations, making Methyl 2-cyano-4-fluoro-6-methylbenzoate essential for precise synthetic applications in medicinal chemistry.
CAS Number | 877151-43-4 |
Molecular Formula | C10H8FNO2 |
Purity | ≥95% |
IUPAC Name | methyl 2-cyano-4-fluoro-6-methylbenzoate |
InChI | InChI=1S/C10H8FNO2/c1-6-3-8(11)4-7(5-12)9(6)10(13)14-2/h3-4H,1-2H3 |
InChIKey | LVGDEACFPFFUFB-UHFFFAOYSA-N |
SMILES | CC1=CC(=CC(=C1C(=O)OC)C#N)F |