For research use only. Not for therapeutic Use.
Methyl 2-cyano-4-nitrobenzoate (Cat.No:L004057) is a pivotal compound in organic synthesis. Its unique structure, incorporating a cyano and nitro group, confers distinctive reactivity and properties. This compound serves as a valuable intermediate in the synthesis of specialized organic molecules, with applications in pharmaceutical and chemical research.
CAS Number | 1628431-64-0 |
Molecular Formula | C9H6N2O4 |
Purity | ≥95% |
IUPAC Name | methyl 2-cyano-4-nitrobenzoate |
InChI | InChI=1S/C9H6N2O4/c1-15-9(12)8-3-2-7(11(13)14)4-6(8)5-10/h2-4H,1H3 |
InChIKey | HMVDETRIOVTGTG-UHFFFAOYSA-N |
SMILES | COC(=O)C1=C(C=C(C=C1)[N+](=O)[O-])C#N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |