For research use only. Not for therapeutic Use.
Methyl 2-ethylbenzoate (Cat.No:L004142) is a significant compound with versatile applications. Its distinct structure, combining an ethyl group with a benzoate moiety, grants it unique reactivity and properties. This compound finds use as a valuable building block in the synthesis of various organic molecules, particularly in pharmaceutical and chemical research.
CAS Number | 50604-01-8 |
Molecular Formula | C10H12O2 |
Purity | ≥95% |
IUPAC Name | methyl 2-ethylbenzoate |
InChI | InChI=1S/C10H12O2/c1-3-8-6-4-5-7-9(8)10(11)12-2/h4-7H,3H2,1-2H3 |
InChIKey | KQQKFHNRMJHXLR-UHFFFAOYSA-N |
SMILES | CCC1=CC=CC=C1C(=O)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |