Home
>
Chemical Reagents>Organometallic Reagents> Methyl 2-hydroxy-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate
For research use only. Not for therapeutic Use.
Methyl 2-hydroxy-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate(Cat No.:L006778). It features a benzoate backbone substituted with a boron-containing heterocyclic compound. This compound is widely used in organic synthesis, particularly in Suzuki-Miyaura cross-coupling reactions. Its unique boron-containing structure makes it essential for creating complex organic molecules, including pharmaceuticals and agrochemicals. Researchers employ it as a key intermediate, enabling the formation of diverse chemical bonds and contributing to the synthesis of various biologically active compounds.
CAS Number | 1352730-33-6 |
Molecular Formula | C14H19BO5 |
Purity | ≥95% |
IUPAC Name | methyl 2-hydroxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
InChI | InChI=1S/C14H19BO5/c1-13(2)14(3,4)20-15(19-13)9-6-7-11(16)10(8-9)12(17)18-5/h6-8,16H,1-5H3 |
InChIKey | WENZFCWDGSUVBI-UHFFFAOYSA-N |
SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)O)C(=O)OC |