For research use only. Not for therapeutic Use.
Methyl (2-methoxyphenyl)acetate(Cat No.:L046921)is an aromatic ester commonly used in organic synthesis and pharmaceutical research. The compound features a methoxy group attached to a phenyl ring and a methyl ester group linked to the acetic acid backbone. This structure provides a pleasant, fruity fragrance, making it valuable in the flavor and fragrance industries. Additionally, its chemical reactivity allows it to serve as an intermediate in the synthesis of more complex molecules, particularly in drug discovery and fine chemicals. Researchers utilize it for its versatility in various chemical transformations.
CAS Number | 27798-60-3 |
Molecular Formula | C10H12O3 |
Purity | ≥95% |
IUPAC Name | methyl 2-(2-methoxyphenyl)acetate |
InChI | InChI=1S/C10H12O3/c1-12-9-6-4-3-5-8(9)7-10(11)13-2/h3-6H,7H2,1-2H3 |
InChIKey | BNQRSYFOIRGRKV-UHFFFAOYSA-N |
SMILES | COC1=CC=CC=C1CC(=O)OC |