For research use only. Not for therapeutic Use.
Methyl 2-methyl acetoacetate （Cat No.:M076792）, is a chemical compound commonly used as a versatile building block in organic synthesis. It belongs to the class of compounds known as acetoacetates and is widely utilized in the pharmaceutical, agrochemical, and chemical industries for the production of various valuable compounds. Methyl 2-methyl acetoacetate can undergo various chemical reactions, including condensation, esterification, and oxidation, to form complex organic molecules. Its reactivity and role as a precursor in the synthesis of pharmaceuticals, agrochemicals, and fine chemicals make it an important compound in organic chemistry research and industrial applications.
| Catalog Number | M076792 |
| CAS Number | 17094-21-2 |
| Molecular Formula | C6H10O3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | methyl 2-methyl-3-oxobutanoate |
| InChI | InChI=1S/C6H10O3/c1-4(5(2)7)6(8)9-3/h4H,1-3H3 |
| InChIKey | NDTWZHURUDSPQV-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C)C(=O)OC |
