Home
>
Chemical Reagents>Heterocyclic Building Blocks> Methyl 2-oxo-2,3-dihydro-1h-imidazole-4-carboxylate
For research use only. Not for therapeutic Use.
Methyl 2-oxo-2,3-dihydro-1H-imidazole-4-carboxylate(CAT: L039009) is a high-purity heterocyclic compound featuring an imidazole core with a keto group and a methyl ester functionality. This versatile molecule serves as an essential building block in pharmaceutical and chemical research, particularly in the synthesis of bioactive compounds and complex organic frameworks. Its well-defined structure makes it valuable for medicinal chemistry applications, including the development of novel therapeutic agents. With consistent quality and exceptional stability, Methyl 2-oxo-2,3-dihydro-1H-imidazole-4-carboxylate supports innovative research in drug discovery, organic synthesis, and advanced material science.
CAS Number | 20901-53-5 |
Molecular Formula | C5H6N2O3 |
Purity | ≥95% |
IUPAC Name | methyl 2-oxo-1,3-dihydroimidazole-4-carboxylate |
InChI | InChI=1S/C5H6N2O3/c1-10-4(8)3-2-6-5(9)7-3/h2H,1H3,(H2,6,7,9) |
InChIKey | LMOLZFSPLCXIHV-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CNC(=O)N1 |