Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> Methyl 2-(piperidin-4-yl)acetate hydrochloride
For research use only. Not for therapeutic Use.
Methyl 2-(piperidin-4-yl)acetate hydrochloride (Cat.No:L045417) is a chemical compound used in organic synthesis. It contains a piperidine ring and an acetate moiety, making it valuable for creating diverse molecules in medicinal chemistry and other research fields. This compound serves as a building block for the preparation of various pharmaceutical and chemical compounds.
Catalog Number | L045417 |
CAS Number | 81270-37-3 |
Molecular Formula | C8H16ClNO2 |
Purity | ≥95% |
IUPAC Name | methyl 2-piperidin-4-ylacetate;hydrochloride |
InChI | InChI=1S/C8H15NO2.ClH/c1-11-8(10)6-7-2-4-9-5-3-7;/h7,9H,2-6H2,1H3;1H |
InChIKey | ADBDFGZYGJGDNJ-UHFFFAOYSA-N |