For research use only. Not for therapeutic Use.
Methyl 2-(triphenylphosphoranylidene)acetate（Cat No.:R000264）is a chemical compound commonly used in organic synthesis, particularly in Wittig reactions. It features a triphenylphosphoranylidene group attached to an acetate moiety, which facilitates the formation of carbon-carbon double bonds. This compound plays a key role in the creation of alkenes, especially in the synthesis of complex molecules with high precision. Methyl 2-(triphenylphosphoranylidene)acetate is used in the development of pharmaceuticals, agrochemicals, and other fine chemicals. Its versatility in synthetic chemistry makes it a valuable tool in creating a wide range of organic compounds with diverse applications.
| CAS Number | 2605-67-6 |
| Synonyms | methyl 2-(triphenyl-λ5-phosphanylidene)acetate |
| Molecular Formula | C21H19O2P |
| Purity | ≥95% |
| IUPAC Name | methyl 2-(triphenyl-lambda5-phosphanylidene)acetate |
| InChI | InChI=1S/C21H19O2P/c1-23-21(22)17-24(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-17H,1H3 |
| InChIKey | NTNUDYROPUKXNA-UHFFFAOYSA-N |
| SMILES | COC(=O)C=P(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
