Home
>
Chemical Reagents>Heterocyclic Building Blocks> methyl 2,3-dioxo-2,3-dihydro-1H-indole-6-carboxylate
For research use only. Not for therapeutic Use.
Methyl 2,3-dioxo-2,3-dihydro-1H-indole-6-carboxylate(Cat No.:L028259)is a heterocyclic compound featuring a methyl ester group at the 6-position of an indole ring, along with a diketone functionality at the 2 and 3 positions. This compound is valuable in pharmaceutical research and organic synthesis as a building block for developing bioactive molecules, including potential drug candidates. Its structure allows for versatile chemical reactions, including cyclization and functionalization, making it useful in the synthesis of complex molecular frameworks. High purity ensures reliable performance in advanced research and medicinal chemistry applications.
Catalog Number | L028259 |
CAS Number | 213670-35-0 |
Molecular Formula | C10H7NO4 |
Purity | ≥95% |
IUPAC Name | methyl 2,3-dioxo-1H-indole-6-carboxylate |
InChI | InChI=1S/C10H7NO4/c1-15-10(14)5-2-3-6-7(4-5)11-9(13)8(6)12/h2-4H,1H3,(H,11,12,13) |
InChIKey | WUSOZUAKIZDOTD-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CC2=C(C=C1)C(=O)C(=O)N2 |