For research use only. Not for therapeutic Use.
Methyl 2,3,4,6-Tetra-O-acetyl-1-thio-α-D-mannopyranoside(CAT: L046010) is a thioglycoside derivative of mannose, commonly used in carbohydrate chemistry and glycosylation reactions. The acetyl groups protect the hydroxyl groups, enhancing the compound’s stability and making it suitable for use as a glycosyl donor in the synthesis of oligosaccharides and glycoconjugates. The sulfur linkage at the anomeric position allows selective glycosylation with various acceptors, facilitating the construction of complex carbohydrate structures in biological and pharmaceutical research. Methyl 2,3,4,6-Tetra-O-acetyl-1-thio-α-D-mannopyranoside is valuable in glycoscience, supporting the synthesis of glycans for studying cellular recognition processes, immune response, and therapeutic developments.
Catalog Number | L046010 |
CAS Number | 64550-71-6 |
Molecular Formula | C15H22O9S |
Purity | ≥95% |
IUPAC Name | [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-methylsulfanyloxan-2-yl]methyl acetate |
InChI | InChI=1S/C15H22O9S/c1-7(16)20-6-11-12(21-8(2)17)13(22-9(3)18)14(23-10(4)19)15(24-11)25-5/h11-15H,6H2,1-5H3/t11-,12-,13+,14+,15-/m1/s1 |
InChIKey | XWFUCHLBRWBKGN-NIFZNCRKSA-N |