For research use only. Not for therapeutic Use.
Methyl 2,5-dihydroxycinnamate (Cat.No:L003362) is a significant chemical compound with diverse applications in pharmaceutical and food industries. Its unique structure and antioxidant properties make it a valuable component in the development of health-promoting products.
Catalog Number | L003362 |
CAS Number | 123064-80-2 |
Molecular Formula | C10H10O4 |
Purity | ≥95% |
IUPAC Name | methyl (E)-3-(2,5-dihydroxyphenyl)prop-2-enoate |
InChI | InChI=1S/C10H10O4/c1-14-10(13)5-2-7-6-8(11)3-4-9(7)12/h2-6,11-12H,1H3/b5-2+ |
InChIKey | BQCNSTFWSKOWMA-GORDUTHDSA-N |
SMILES | COC(=O)/C=C/C1=C(C=CC(=C1)O)O |