For research use only. Not for therapeutic Use.
Methyl (2R)-2-amino-2-(4-bromophenyl)acetate HCl(Cat No.:L018017)is a chiral compound used in pharmaceutical research and organic synthesis. The molecule features an amino group attached to a stereochemically defined (2R) center, with a 4-bromophenyl group and a methyl ester functionality, provided as a hydrochloride salt for enhanced stability and solubility. This compound is particularly valuable as an intermediate in the synthesis of enantiomerically pure drugs and other biologically active molecules. Its chiral center and functional groups make it essential for researchers focused on drug discovery, medicinal chemistry, and the development of advanced therapeutic agents.
CAS Number | 1391389-21-1 |
Molecular Formula | C9H11BrClNO2 |
Purity | ≥95% |
IUPAC Name | methyl (2R)-2-amino-2-(4-bromophenyl)acetate;hydrochloride |
InChI | InChI=1S/C9H10BrNO2.ClH/c1-13-9(12)8(11)6-2-4-7(10)5-3-6;/h2-5,8H,11H2,1H3;1H/t8-;/m1./s1 |
InChIKey | CSBFDIDFULVKDP-DDWIOCJRSA-N |
SMILES | COC(=O)C(C1=CC=C(C=C1)Br)N.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |