For research use only. Not for therapeutic Use.
Methyl 3-((3-(Dimethylamino)propyl)amino)propanoate(Cat No.:L047275)is a versatile compound used in organic synthesis and pharmaceutical research. It features a methyl ester group and a dimethylamino-propylamino side chain, providing unique reactivity for creating complex molecules. This compound is particularly valuable as an intermediate in the synthesis of biologically active substances, such as potential drug candidates or fine chemicals. The presence of both ester and amine functionalities allows for diverse chemical modifications, making it essential for researchers focused on drug discovery, medicinal chemistry, and the development of advanced materials.
CAS Number | 90796-69-3 |
Molecular Formula | C9H20N2O2 |
Purity | ≥95% |
IUPAC Name | methyl 3-[3-(dimethylamino)propylamino]propanoate |
InChI | InChI=1S/C9H20N2O2/c1-11(2)8-4-6-10-7-5-9(12)13-3/h10H,4-8H2,1-3H3 |
InChIKey | WQKFFWPHFBTKLF-UHFFFAOYSA-N |
SMILES | CN(C)CCCNCCC(=O)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |