For research use only. Not for therapeutic Use.
Methyl 3-amino-2-benzo[b]furancarboxylate(Cat No.:L039180)is a valuable intermediate in the synthesis of complex organic compounds, particularly in pharmaceutical research. This compound features a benzo[b]furan ring system with an amino group at the 3-position and a methyl ester group at the 2-position. It serves as a key building block for the development of bioactive molecules, including potential therapeutic agents targeting various biological pathways. Its versatile structure allows for a wide range of chemical modifications, making it essential in medicinal chemistry and drug discovery efforts.
CAS Number | 57805-85-3 |
Molecular Formula | C10H9NO3 |
Purity | ≥95% |
IUPAC Name | methyl 3-amino-1-benzofuran-2-carboxylate |
InChI | InChI=1S/C10H9NO3/c1-13-10(12)9-8(11)6-4-2-3-5-7(6)14-9/h2-5H,11H2,1H3 |
InChIKey | OBUMBRZSVRGWFY-UHFFFAOYSA-N |
SMILES | COC(=O)C1=C(C2=CC=CC=C2O1)N |