For research use only. Not for therapeutic Use.
Methyl 3-amino-3-(2-methoxyphenyl)propanoate hydrochloride (Cat.No:L004088) is a crucial compound in pharmaceutical research. Its unique structure, incorporating an amino group and a methoxyphenyl moiety, offers diverse reactivity. This compound serves as a valuable building block in the development of bioactive molecules, particularly in the field of pharmaceuticals.
CAS Number | 1269634-07-2 |
Molecular Formula | C11H16ClNO3 |
Purity | ≥95% |
IUPAC Name | methyl 3-amino-3-(2-methoxyphenyl)propanoate;hydrochloride |
InChI | InChI=1S/C11H15NO3.ClH/c1-14-10-6-4-3-5-8(10)9(12)7-11(13)15-2;/h3-6,9H,7,12H2,1-2H3;1H |
InChIKey | RQROSGBYFAHSDJ-UHFFFAOYSA-N |
SMILES | COC1=CC=CC=C1C(CC(=O)OC)N.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |