Home
>
Chemical Reagents>Organometallic Reagents> Methyl 3-amino-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate
For research use only. Not for therapeutic Use.
Methyl 3-amino-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate(Cat No.:L022558)is an aromatic ester widely used in pharmaceutical and chemical research. Featuring an amino group at the 3-position and a boronic ester group at the 4-position on the benzoate ring, this compound is valuable for Suzuki-Miyaura cross-coupling reactions. Its structure facilitates the synthesis of complex bioactive molecules, making it essential in drug discovery and development. Methyl 3-amino-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate is crucial for researchers focused on advancing medicinal chemistry and organic synthesis.
CAS Number | 850689-26-8 |
Molecular Formula | C14H20BNO4 |
Purity | ≥95% |
IUPAC Name | methyl 3-amino-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
InChI | InChI=1S/C14H20BNO4/c1-13(2)14(3,4)20-15(19-13)10-7-6-9(8-11(10)16)12(17)18-5/h6-8H,16H2,1-5H3 |
InChIKey | CVIBCBYHFMOOBF-UHFFFAOYSA-N |
SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C(=O)OC)N |