For research use only. Not for therapeutic Use.
Methyl 3-amino-5-bromobenzoate(Cat No.:L015154)is an aromatic ester featuring an amino group at the 3-position and a bromine atom at the 5-position of the benzoate core. This compound is widely used in pharmaceutical research and organic synthesis as a versatile intermediate for developing biologically active molecules, including potential drug candidates. The bromine and amino groups allow for diverse reactivity, making it suitable for cross-coupling reactions and further functionalization. Researchers in medicinal chemistry value this compound for creating complex structures and exploring innovative therapeutic agents.
CAS Number | 706791-83-5 |
Molecular Formula | C8H8BrNO2 |
Purity | ≥95% |
IUPAC Name | methyl 3-amino-5-bromobenzoate |
InChI | InChI=1S/C8H8BrNO2/c1-12-8(11)5-2-6(9)4-7(10)3-5/h2-4H,10H2,1H3 |
InChIKey | MNXLJDUZJCMJCI-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CC(=CC(=C1)Br)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |