For research use only. Not for therapeutic Use.
Methyl 3-aminophenylacetate(Cat No.:L045943)is an organic compound used in pharmaceutical research and organic synthesis. It features a phenyl ring with an amino group at the 3-position and an ester group at the alpha-carbon of the acetate chain. This structure provides versatility for various chemical transformations, making it a valuable intermediate in the synthesis of complex molecules. It is particularly useful in the development of biologically active compounds, such as potential drug candidates. Researchers utilize this compound for its reactivity and ability to be further functionalized in medicinal chemistry.
CAS Number | 52913-11-8 |
Molecular Formula | C9H11NO2 |
Purity | ≥95% |
IUPAC Name | methyl 2-(3-aminophenyl)acetate |
InChI | InChI=1S/C9H11NO2/c1-12-9(11)6-7-3-2-4-8(10)5-7/h2-5H,6,10H2,1H3 |
InChIKey | BVKGNQRDVFGNIW-UHFFFAOYSA-N |
SMILES | COC(=O)CC1=CC(=CC=C1)N |