For research use only. Not for therapeutic Use.
Methyl 3-(benzyloxy)-4,6-dibromopicolinate (Cat.No:L003648) is a significant chemical compound in organic synthesis. Its distinctive structure, incorporating bromine and benzyl groups, lends itself to diverse reactivity. This compound is employed as a key intermediate in the preparation of specialized molecules for pharmaceutical and agrochemical applications.
Catalog Number | L003648 |
CAS Number | 321596-56-9 |
Molecular Formula | C14H11Br2NO3 |
Purity | ≥95% |
IUPAC Name | methyl 4,6-dibromo-3-phenylmethoxypyridine-2-carboxylate |
InChI | InChI=1S/C14H11Br2NO3/c1-19-14(18)12-13(10(15)7-11(16)17-12)20-8-9-5-3-2-4-6-9/h2-7H,8H2,1H3 |
InChIKey | CSAZPQZAODHVLZ-UHFFFAOYSA-N |
SMILES | COC(=O)C1=C(C(=CC(=N1)Br)Br)OCC2=CC=CC=C2 |