For research use only. Not for therapeutic Use.
Methyl 3-bromo-4-(hydroxymethyl)benzoate(CAT: L030727) is a high-purity aromatic ester widely utilized in pharmaceutical and chemical research. Featuring a benzoate core with a bromine atom at the 3-position and a hydroxymethyl group at the 4-position, this compound serves as a versatile intermediate in the synthesis of bioactive molecules, fine chemicals, and advanced materials. Its unique structure and reactivity make it suitable for medicinal chemistry applications, including drug discovery and the development of novel therapeutic agents. Methyl 3-bromo-4-(hydroxymethyl)benzoate ensures reliable performance and consistency, supporting innovation in organic synthesis and chemical development.
CAS Number | 90326-62-8 |
Molecular Formula | C9H9BrO3 |
Purity | ≥95% |
IUPAC Name | methyl 3-bromo-4-(hydroxymethyl)benzoate |
InChI | InChI=1S/C9H9BrO3/c1-13-9(12)6-2-3-7(5-11)8(10)4-6/h2-4,11H,5H2,1H3 |
InChIKey | FHBYEUICKVHSAL-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CC(=C(C=C1)CO)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |