For research use only. Not for therapeutic Use.
Methyl 3-chloro-4-hydroxy-5-nitrobenzoate (Cat.No:L003932) is a significant chemical compound with versatile applications. Its distinct structure, featuring a chloro-nitrophenyl ester, imparts unique reactivity and properties. This compound serves as a valuable intermediate in the synthesis of specialized organic molecules for various industrial and pharmaceutical applications.
CAS Number | 40256-81-3 |
Molecular Formula | C8H6ClNO5 |
Purity | ≥95% |
IUPAC Name | methyl 3-chloro-4-hydroxy-5-nitrobenzoate |
InChI | InChI=1S/C8H6ClNO5/c1-15-8(12)4-2-5(9)7(11)6(3-4)10(13)14/h2-3,11H,1H3 |
InChIKey | AXSBTIAHZUQRMI-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CC(=C(C(=C1)Cl)O)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |