For research use only. Not for therapeutic Use.
Methyl 3-Chloro-4-iodobenzoate(Cat No.:L038588)is an aromatic ester used in organic synthesis and pharmaceutical research. The compound features a benzoate ester with chlorine and iodine atoms at the 3 and 4 positions, respectively, providing significant reactivity for various chemical transformations. It is particularly valuable as an intermediate in the synthesis of complex molecules, including those with potential biological activity. The halogen atoms allow for versatile functionalization, such as cross-coupling reactions, making this compound essential for researchers focused on drug discovery and the development of advanced materials.
CAS Number | 874569-39-8 |
Molecular Formula | C8H6ClIO2 |
Purity | ≥95% |
IUPAC Name | methyl 3-chloro-4-iodobenzoate |
InChI | InChI=1S/C8H6ClIO2/c1-12-8(11)5-2-3-7(10)6(9)4-5/h2-4H,1H3 |
InChIKey | RSEIQPMWJLDXJZ-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CC(=C(C=C1)I)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |