For research use only. Not for therapeutic Use.
Methyl 3-(chlorosulfonyl)benzoate(Cat No.:L011683)is an organic compound with the molecular formula C8H7ClO5S. It features a benzoate ester functionalized with a chlorosulfonyl group at the 3-position, enhancing its reactivity. This compound is crucial as a synthetic intermediate in pharmaceutical manufacturing and organic chemistry research. It is particularly useful in the synthesis of sulfonyl derivatives and related molecules. Its ability to act as an electrophile allows it to engage in various substitution reactions, making it indispensable for developing novel chemical entities with potential therapeutic applications.
CAS Number | 63555-50-0 |
Molecular Formula | C8H7ClO4S |
Purity | ≥95% |
IUPAC Name | methyl 3-chlorosulfonylbenzoate |
InChI | InChI=1S/C8H7ClO4S/c1-13-8(10)6-3-2-4-7(5-6)14(9,11)12/h2-5H,1H3 |
InChIKey | SQIBNKUEUWGZBH-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CC(=CC=C1)S(=O)(=O)Cl |