For research use only. Not for therapeutic Use.
Methyl 3-fluorobenzene-1-sulfonate（Cat No.:L007485）, is a vital organic compound in the field of chemical synthesis. Its molecular structure comprises a fluorine atom attached to the benzene ring at the 3-position and a sulfonate group (-SO3CH3) at the 1-position. This compound is widely used in pharmaceutical and agrochemical industries, serving as a crucial intermediate in the synthesis of various biologically active molecules. Its versatile reactivity makes it valuable in the creation of complex organic compounds, contributing significantly to the development of new drugs and agricultural chemicals.
| Catalog Number | L007485 |
| CAS Number | 1865148-58-8 |
| Molecular Formula | C7H7FO3S |
| Purity | ≥95% |
| IUPAC Name | methyl 3-fluorobenzenesulfonate |
| InChI | InChI=1S/C7H7FO3S/c1-11-12(9,10)7-4-2-3-6(8)5-7/h2-5H,1H3 |
| InChIKey | KLINELVCVRRAJI-UHFFFAOYSA-N |
| SMILES | COS(=O)(=O)C1=CC=CC(=C1)F |
