For research use only. Not for therapeutic Use.
Methyl 3-hydroxycyclobutanecarboxylate(Cat No.:L032827)is an important intermediate in organic synthesis, featuring a cyclobutane ring with a hydroxyl group and an ester functional group. Its unique structure offers reactivity for various chemical transformations, making it valuable in pharmaceutical and chemical research. This compound is commonly used in the synthesis of bioactive molecules, including drug candidates and fine chemicals. The ester group allows for easy modifications, while the cyclobutane ring provides rigidity, making it useful for creating complex structures in medicinal chemistry, drug development, and materials science applications.
CAS Number | 63485-51-8 |
Molecular Formula | C6H10O3 |
Purity | ≥95% |
IUPAC Name | methyl 3-hydroxycyclobutane-1-carboxylate |
InChI | InChI=1S/C6H10O3/c1-9-6(8)4-2-5(7)3-4/h4-5,7H,2-3H2,1H3 |
InChIKey | BYKHAEUVLSBWSU-UHFFFAOYSA-N |
SMILES | COC(=O)C1CC(C1)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |