For research use only. Not for therapeutic Use.
Methyl 3-Oxo-1-Methyl-Cyclobutanecarboxylate(CAT: L028071) is a high-purity cyclic ester compound widely utilized in pharmaceutical, agrochemical, and organic synthesis research. Featuring a cyclobutanone core with a methyl group and a methyl ester functionality, this compound serves as a versatile intermediate for the synthesis of complex organic molecules, bioactive compounds, and fine chemicals. Its unique structure makes it particularly valuable in medicinal chemistry for the development of therapeutic agents and structure-activity relationship studies. With excellent stability and reactivity, Methyl 3-Oxo-1-Methyl-Cyclobutanecarboxylate ensures precision and reliability, making it an essential tool for advanced research and innovative synthetic applications.
Catalog Number | L028071 |
CAS Number | 1408075-88-6 |
Molecular Formula | C7H10O3 |
Purity | ≥95% |
IUPAC Name | methyl 1-methyl-3-oxocyclobutane-1-carboxylate |
InChI | InChI=1S/C7H10O3/c1-7(6(9)10-2)3-5(8)4-7/h3-4H2,1-2H3 |
InChIKey | AFJSYXYJQWHNMP-UHFFFAOYSA-N |
SMILES | CC1(CC(=O)C1)C(=O)OC |