For research use only. Not for therapeutic Use.
Methyl 3-(p-tolyl)propanoate(Cat No.:L019805)is a high-purity ester widely used in pharmaceutical research and organic synthesis. This compound, featuring a p-tolyl group attached to a propanoate ester, is a valuable intermediate in the development of various bioactive molecules. Its structure allows for versatile applications in medicinal chemistry, particularly in creating complex aromatic compounds. Methyl 3-(p-tolyl)propanoate is essential for research focused on synthesizing new therapeutic agents, providing reliable performance in advanced chemical synthesis and facilitating the exploration of novel synthetic pathways.
CAS Number | 56955-36-3 |
Molecular Formula | C11H14O2 |
Purity | ≥95% |
IUPAC Name | methyl 3-(4-methylphenyl)propanoate |
InChI | InChI=1S/C11H14O2/c1-9-3-5-10(6-4-9)7-8-11(12)13-2/h3-6H,7-8H2,1-2H3 |
InChIKey | ZYODXRYBYZMUNL-UHFFFAOYSA-N |
SMILES | CC1=CC=C(C=C1)CCC(=O)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |