For research use only. Not for therapeutic Use.
Methyl 3-phenylisoxazole-5-carboxylate (Cat.No:L003844) is a pivotal compound in organic synthesis. Its distinctive isoxazole ring and ester functionality impart unique reactivity and versatility. This compound serves as a valuable building block in the preparation of specialized organic molecules with various industrial and pharmaceutical applications. Its versatile nature makes it an essential component in the development of innovative materials and bioactive compounds, underscoring its significance in contemporary chemical research.
CAS Number | 1081-30-7 |
Molecular Formula | C11H9NO3 |
Purity | ≥95% |
IUPAC Name | methyl 3-phenyl-1,2-oxazole-5-carboxylate |
InChI | InChI=1S/C11H9NO3/c1-14-11(13)10-7-9(12-15-10)8-5-3-2-4-6-8/h2-7H,1H3 |
InChIKey | SSDKYDGBJLXLAO-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |