For research use only. Not for therapeutic Use.
Methyl 3-((tert-butoxycarbonyl)amino)picolinate(Cat No.:L037389)is a pyridine-based compound commonly used in pharmaceutical research and organic synthesis. Featuring a picolinate core with a methyl ester and a tert-butoxycarbonyl (Boc)-protected amino group, this compound serves as a versatile intermediate in the synthesis of complex molecules, including potential drug candidates. The Boc group provides protection during chemical reactions, allowing for selective deprotection when needed. Researchers in medicinal chemistry value this compound for its reactivity and utility in creating innovative therapeutics and fine chemicals, contributing to drug discovery and development.
CAS Number | 912369-42-7 |
Molecular Formula | C12H16N2O4 |
Purity | ≥95% |
IUPAC Name | methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-2-carboxylate |
InChI | InChI=1S/C12H16N2O4/c1-12(2,3)18-11(16)14-8-6-5-7-13-9(8)10(15)17-4/h5-7H,1-4H3,(H,14,16) |
InChIKey | AWHQAUKVCWXFSV-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)NC1=C(N=CC=C1)C(=O)OC |