For research use only. Not for therapeutic Use.
Methyl 3,4-difluoro-5-methylbenzoate(CAT: L000051) is a chemical compound with applications in organic chemistry. This compound is valued as an intermediate for the synthesis of various organic compounds, contributing to the diversification of chemical synthesis. Its specific structure, featuring a combination of fluoro and methyl substituents on a benzoate moiety, provides opportunities for creating specialized molecules with potential uses in various areas within the field of organic chemistry.
CAS Number | 1379218-01-5 |
Molecular Formula | C9H8F2O2 |
Purity | ≥95% |
IUPAC Name | methyl 3,4-difluoro-5-methylbenzoate |
InChI | InChI=1S/C9H8F2O2/c1-5-3-6(9(12)13-2)4-7(10)8(5)11/h3-4H,1-2H3 |
InChIKey | OPFJDFQCDXNOMQ-UHFFFAOYSA-N |