For research use only. Not for therapeutic Use.
Methyl 3,5-dibromobenzoate(Cat No.:L019850)is a halogenated aromatic ester characterized by its two bromine atoms positioned on a benzene ring, providing distinctive reactivity and electronic properties. This compound serves as an essential intermediate in organic synthesis, particularly in the preparation of biologically active molecules and polymers. Its bromine substituents are key for facilitating various chemical transformations, including Suzuki coupling reactions, which are crucial for creating complex pharmaceutical agents. Methyl 3,5-dibromobenzoate is widely utilized in medicinal chemistry to synthesize compounds with potential therapeutic applications, enhancing drug discovery efforts.
CAS Number | 51329-15-8 |
Molecular Formula | C8H6Br2O2 |
Purity | ≥95% |
IUPAC Name | methyl 3,5-dibromobenzoate |
InChI | InChI=1S/C8H6Br2O2/c1-12-8(11)5-2-6(9)4-7(10)3-5/h2-4H,1H3 |
InChIKey | GSMAWUZTAIOCPL-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CC(=CC(=C1)Br)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |