For research use only. Not for therapeutic Use.
Methyl 3,5-dibromopyrazine-2-carboxylate(CAT: L041128) is a brominated pyrazine derivative featuring two bromine atoms at the 3- and 5-positions, with a methyl ester group attached to the carboxyl group at the 2-position. This compound is commonly utilized as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and advanced materials due to its halogenated structure, which allows for further functionalization via cross-coupling reactions. The pyrazine ring adds stability and reactivity, making it useful in the development of heterocyclic compounds for research. Its versatility in chemical synthesis positions it as a key building block in various chemical and medicinal applications.
CAS Number | 1035818-91-7 |
Molecular Formula | C6H4Br2N2O2 |
Purity | ≥95% |
IUPAC Name | methyl 3,5-dibromopyrazine-2-carboxylate |
InChI | InChI=1S/C6H4Br2N2O2/c1-12-6(11)4-5(8)10-3(7)2-9-4/h2H,1H3 |
InChIKey | UGSDJCJVOHRWIA-UHFFFAOYSA-N |