For research use only. Not for therapeutic Use.
Methyl 3,5-dichloro-4-methylbenzoate(Cat No.:L022207)is a high-purity chemical compound used extensively in pharmaceutical and chemical research. With its dichloro and methyl-substituted benzoate structure, this compound serves as a valuable intermediate in the synthesis of various complex molecules, including active pharmaceutical ingredients (APIs) and agrochemicals. Its unique chemical properties make it ideal for use in medicinal chemistry, where it supports the development of new therapeutic agents. This compound is prized for its stability and reactivity, enabling precise modifications in synthetic pathways.
CAS Number | 203573-09-5 |
Molecular Formula | C9H8Cl2O2 |
Purity | ≥95% |
IUPAC Name | methyl 3,5-dichloro-4-methylbenzoate |
InChI | InChI=1S/C9H8Cl2O2/c1-5-7(10)3-6(4-8(5)11)9(12)13-2/h3-4H,1-2H3 |
InChIKey | WWZXFVCHCWYKJD-UHFFFAOYSA-N |
SMILES | CC1=C(C=C(C=C1Cl)C(=O)OC)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |