Home
>
Chemical Reagents>Organic Building Blocks> Methyl 4-(1-aminocyclopropyl)benzoate hydrochloride
For research use only. Not for therapeutic Use.
Methyl 4-(1-aminocyclopropyl)benzoate hydrochloride(Cat No.:L041135)is a hydrochloride salt form of an ester compound, featuring an aminocyclopropyl group attached to a benzoate core. This compound is commonly used in pharmaceutical research as a building block for the synthesis of biologically active molecules, including potential drug candidates. The aminocyclopropyl group provides unique reactivity, making it suitable for a variety of chemical transformations, particularly in the development of cyclopropyl-containing therapeutics. Researchers in medicinal chemistry value this compound for exploring innovative therapeutic agents and chemical modifications.
Catalog Number | L041135 |
CAS Number | 1014645-87-4 |
Molecular Formula | C11H14ClNO2 |
Purity | ≥95% |
IUPAC Name | methyl 4-(1-aminocyclopropyl)benzoate;hydrochloride |
InChI | InChI=1S/C11H13NO2.ClH/c1-14-10(13)8-2-4-9(5-3-8)11(12)6-7-11;/h2-5H,6-7,12H2,1H3;1H |
InChIKey | SZUAJCIGBDCCPA-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CC=C(C=C1)C2(CC2)N.Cl |