Home
>
Chemical Reagents>Heterocyclic Building Blocks> Methyl 4-((1H-1,2,4-triazol-3-yl)methyl)benzoate
For research use only. Not for therapeutic Use.
Methyl 4-((1H-1,2,4-triazol-3-yl)methyl)benzoate is an aromatic ester featuring a benzoate moiety linked to a triazole ring through a methylene bridge. This compound is of interest in medicinal chemistry due to its potential biological activities, including antifungal and antimicrobial properties. The triazole group enhances the compound’s solubility and reactivity, making it suitable for further functionalization. Its unique structure allows for the synthesis of various derivatives, contributing to the development of new therapeutic agents and bioactive compounds in drug discovery.
CAS Number | 1785765-04-9 |
Molecular Formula | C11H11N3O2 |
Purity | ≥95% |
IUPAC Name | methyl 4-(1H-1,2,4-triazol-5-ylmethyl)benzoate |
InChI | InChI=1S/C11H11N3O2/c1-16-11(15)9-4-2-8(3-5-9)6-10-12-7-13-14-10/h2-5,7H,6H2,1H3,(H,12,13,14) |
InChIKey | TYFFOCNYTODYNV-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CC=C(C=C1)CC2=NC=NN2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |