For research use only. Not for therapeutic Use.
Methyl 4-amino-2-(trifluoromethyl)benzoate(Cat No.:L026967)is a specialized organic compound used extensively in pharmaceutical and chemical research. This compound features an amino group and a trifluoromethyl group attached to a benzoate ester, making it a valuable intermediate in the synthesis of complex molecules. Its unique structure enables diverse chemical modifications, which are crucial in the development of new therapeutic agents and agrochemicals. Methyl 4-amino-2-(trifluoromethyl)benzoate supports high-precision synthesis and innovative research, contributing to advancements in medicinal chemistry and drug discovery.
CAS Number | 894796-87-3 |
Molecular Formula | C9H8F3NO2 |
Purity | ≥95% |
IUPAC Name | methyl 4-amino-2-(trifluoromethyl)benzoate |
InChI | InChI=1S/C9H8F3NO2/c1-15-8(14)6-3-2-5(13)4-7(6)9(10,11)12/h2-4H,13H2,1H3 |
InChIKey | IYEKSDFYHAQYAM-UHFFFAOYSA-N |
SMILES | COC(=O)C1=C(C=C(C=C1)N)C(F)(F)F |