For research use only. Not for therapeutic Use.
Methyl 4-amino-2,5-difluorobenzoate is an aromatic ester featuring an amino group and two fluorine atoms on a benzoate core. This compound serves as a key intermediate in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. The fluorine atoms enhance its chemical stability and lipophilicity, making it valuable in drug design for improving metabolic resistance and biological activity. Its structural versatility allows for further functionalization, making it an important building block in medicinal chemistry and material science research.
Catalog Number | L030746 |
CAS Number | 952285-52-8 |
Molecular Formula | C8H7F2NO2 |
Purity | ≥95% |
IUPAC Name | methyl 4-amino-2,5-difluorobenzoate |
InChI | InChI=1S/C8H7F2NO2/c1-13-8(12)4-2-6(10)7(11)3-5(4)9/h2-3H,11H2,1H3 |
InChIKey | WFHMJOPCOWABHH-UHFFFAOYSA-N |