For research use only. Not for therapeutic Use.
Methyl 4-amino-3,6-dichloropicolinate is a chlorinated pyridine derivative used in agricultural and chemical research. It serves as an intermediate in the synthesis of herbicides and agrochemicals, playing a crucial role in developing effective crop protection solutions. This compound is essential for studying herbicidal activity, optimizing formulations, and understanding environmental impact. Researchers and chemists rely on Methyl 4-amino-3,6-dichloropicolinate for precise and reliable results in advanced agrochemical development and environmental studies, contributing significantly to sustainable agriculture innovations.
CAS Number | 350601-39-7 |
Molecular Formula | C7H6Cl2N2O2 |
Purity | ≥95% |
Appearance | Methanol solution |
IUPAC Name | methyl 4-amino-3,6-dichloropyridine-2-carboxylate |
InChI | InChI=1S/C7H6Cl2N2O2/c1-13-7(12)6-5(9)3(10)2-4(8)11-6/h2H,1H3,(H2,10,11) |
InChIKey | FRMBCYILCYTPHY-UHFFFAOYSA-N |
SMILES | COC(=O)C1=C(C(=CC(=N1)Cl)N)Cl |